C12H12ClF2NO3 — CID 166431779
methyl 4-[2-[(2-chloroacetyl)amino]-1,1-difluoroethyl]benzoate (PubChem CID 166431779) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is methyl 4-[2-[(2-chloroacetyl)amino]-1,1-difluoroethyl]benzoate.
| Compound Name | methyl 4-[2-[(2-chloroacetyl)amino]-1,1-difluoroethyl]benzoate |
|---|---|
| PubChem CID | 166431779 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | methyl 4-[2-[(2-chloroacetyl)amino]-1,1-difluoroethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(F)(F)CNC(=O)CCl)cc1 |
| InChI | InChI=1S/C12H12ClF2NO3/c1-19-11(18)8-2-4-9(5-3-8)12(14,15)7-16-10(17)6-13/h2-5H,6-7H2,1H3,(H,16,17) |
| InChIKey | OYNHKAPVTQBGTN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|