2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid

C12H14F2O4 — CID 61327040

IUPAC2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid
SMILESCOc1ccc(C(F)(F)COCC(=O)O)cc1C
InChIInChI=1S/C12H14F2O4/c1-8-5-9(3-4-10(8)17-2)12(13,14)7-18-6-11(15)16/h3-5H,6-7H2,1-2H3,(H,15,16)
InChIKeyICUUVNYZDIWTTF-UHFFFAOYSA-N
MW260.24 g/mol
LogP2.20
Rot. Bonds6

About 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid

2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid (PubChem CID 61327040) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid
PubChem CID61327040
Molecular FormulaC12H14F2O4
Molecular Weight260.24 g/mol
Exact Mass260.09
IUPAC Name2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid
SMILESCOc1ccc(C(F)(F)COCC(=O)O)cc1C
InChIInChI=1S/C12H14F2O4/c1-8-5-9(3-4-10(8)17-2)12(13,14)7-18-6-11(15)16/h3-5H,6-7H2,1-2H3,(H,15,16)
InChIKeyICUUVNYZDIWTTF-UHFFFAOYSA-N
XLogP2.20
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.24
LogP ≤ 52.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid?
The IUPAC name of 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid (CID 61327040) is 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid.
What is the SMILES notation for 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid?
The canonical SMILES for 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid is COc1ccc(C(F)(F)COCC(=O)O)cc1C.
What is the InChIKey of 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid?
The InChIKey is ICUUVNYZDIWTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O4/c1-8-5-9(3-4-10(8)17-2)12(13,14)7-18-6-11(15)16/h3-5H,6-7H2,1-2H3,(H,15,16).
What are the key properties of 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid?
2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid has a molecular weight of 260.24 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoro-2-(4-methoxy-3-methylphenyl)ethoxy]acetic acid is sourced from PubChem (CID 61327040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).