3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid

C10H9BrF2O3 — CID 116838347

IUPAC3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid
SMILESCOc1ccc(C(F)(F)CC(=O)O)cc1Br
InChIInChI=1S/C10H9BrF2O3/c1-16-8-3-2-6(4-7(8)11)10(12,13)5-9(14)15/h2-4H,5H2,1H3,(H,14,15)
InChIKeyVCRRTTHGAZBACC-UHFFFAOYSA-N
MW295.08 g/mol
LogP3.02
Rot. Bonds4

About 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid

3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid (PubChem CID 116838347) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid.

Molecular Properties

Compound Name3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid
PubChem CID116838347
Molecular FormulaC10H9BrF2O3
Molecular Weight295.08 g/mol
Exact Mass293.97
IUPAC Name3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid
SMILESCOc1ccc(C(F)(F)CC(=O)O)cc1Br
InChIInChI=1S/C10H9BrF2O3/c1-16-8-3-2-6(4-7(8)11)10(12,13)5-9(14)15/h2-4H,5H2,1H3,(H,14,15)
InChIKeyVCRRTTHGAZBACC-UHFFFAOYSA-N
XLogP3.02
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.08
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid?
The IUPAC name of 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid (CID 116838347) is 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid.
What is the SMILES notation for 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid?
The canonical SMILES for 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid is COc1ccc(C(F)(F)CC(=O)O)cc1Br.
What is the InChIKey of 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid?
The InChIKey is VCRRTTHGAZBACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O3/c1-16-8-3-2-6(4-7(8)11)10(12,13)5-9(14)15/h2-4H,5H2,1H3,(H,14,15).
What are the key properties of 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid?
3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid has a molecular weight of 295.08 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid is sourced from PubChem (CID 116838347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).