C10H9BrF2O3 — CID 116838347
3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid (PubChem CID 116838347) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid |
|---|---|
| PubChem CID | 116838347 |
| Molecular Formula | C10H9BrF2O3 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-3,3-difluoropropanoic acid |
| SMILES | COc1ccc(C(F)(F)CC(=O)O)cc1Br |
| InChI | InChI=1S/C10H9BrF2O3/c1-16-8-3-2-6(4-7(8)11)10(12,13)5-9(14)15/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | VCRRTTHGAZBACC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |