C15H22N2O2 — CID 60589490
2-[(4-methoxy-3-methylphenyl)methyl-methylamino]-N-prop-2-enylacetamide (PubChem CID 60589490) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[(4-methoxy-3-methylphenyl)methyl-methylamino]-N-prop-2-enylacetamide.
| Compound Name | 2-[(4-methoxy-3-methylphenyl)methyl-methylamino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 60589490 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-[(4-methoxy-3-methylphenyl)methyl-methylamino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN(C)Cc1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-5-8-16-15(18)11-17(3)10-13-6-7-14(19-4)12(2)9-13/h5-7,9H,1,8,10-11H2,2-4H3,(H,16,18) |
| InChIKey | PERPDSQZFFFITB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|