C17H24N2O — CID 78900344
2-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]-N-prop-2-enylacetamide (PubChem CID 78900344) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]-N-prop-2-enylacetamide.
| Compound Name | 2-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 78900344 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN(Cc1ccc(C)c(C)c1)C1CC1 |
| InChI | InChI=1S/C17H24N2O/c1-4-9-18-17(20)12-19(16-7-8-16)11-15-6-5-13(2)14(3)10-15/h4-6,10,16H,1,7-9,11-12H2,2-3H3,(H,18,20) |
| InChIKey | RNPDXEMJKXNNTR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|