C14H16ClF3O3 — CID 174466804
4-(4-chloro-3-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanal (PubChem CID 174466804) has the molecular formula C14H16ClF3O3 and a molecular weight of 324.73 g/mol. Its IUPAC name is 4-(4-chloro-3-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanal.
| Compound Name | 4-(4-chloro-3-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanal |
|---|---|
| PubChem CID | 174466804 |
| Molecular Formula | C14H16ClF3O3 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-(4-chloro-3-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanal |
| SMILES | COc1cc(C(C)(C)CC(O)(C=O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H16ClF3O3/c1-12(2,7-13(20,8-19)14(16,17)18)9-4-5-10(15)11(6-9)21-3/h4-6,8,20H,7H2,1-3H3 |
| InChIKey | CWVQUXLITDYIDR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|