About 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal
3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal (PubChem CID 142387686) has the molecular formula C12H11ClF2O2
and a molecular weight of 260.67 g/mol. Its IUPAC name is 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal.
Molecular Properties
| Compound Name | 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal |
| PubChem CID | 142387686 |
| Molecular Formula | C12H11ClF2O2 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal |
| SMILES | O=CCC(F)(F)c1ccc(Cl)c(OC2CC2)c1 |
| InChI | InChI=1S/C12H11ClF2O2/c13-10-4-1-8(12(14,15)5-6-16)7-11(10)17-9-2-3-9/h1,4,6-7,9H,2-3,5H2 |
| InChIKey | WKINLPIMIONZEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal?
The IUPAC name of 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal (CID 142387686) is 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal.
What is the SMILES notation for 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal?
The canonical SMILES for 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal is O=CCC(F)(F)c1ccc(Cl)c(OC2CC2)c1.
What is the InChIKey of 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal?
The InChIKey is WKINLPIMIONZEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF2O2/c13-10-4-1-8(12(14,15)5-6-16)7-11(10)17-9-2-3-9/h1,4,6-7,9H,2-3,5H2.
What are the key properties of 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal?
3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal has a molecular weight of 260.67 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal is sourced from PubChem (CID 142387686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).