C12H11ClF2O2 — CID 142387686
3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal (PubChem CID 142387686) has the molecular formula C12H11ClF2O2 and a molecular weight of 260.67 g/mol. Its IUPAC name is 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal.
| Compound Name | 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal |
|---|---|
| PubChem CID | 142387686 |
| Molecular Formula | C12H11ClF2O2 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(4-chloro-3-cyclopropyloxyphenyl)-3,3-difluoropropanal |
| SMILES | O=CCC(F)(F)c1ccc(Cl)c(OC2CC2)c1 |
| InChI | InChI=1S/C12H11ClF2O2/c13-10-4-1-8(12(14,15)5-6-16)7-11(10)17-9-2-3-9/h1,4,6-7,9H,2-3,5H2 |
| InChIKey | WKINLPIMIONZEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|