C14H17ClF2O2 — CID 162262584
1-(4-chloro-3-cyclopentyloxyphenyl)-1,1-difluoropropan-2-ol (PubChem CID 162262584) has the molecular formula C14H17ClF2O2 and a molecular weight of 290.74 g/mol. Its IUPAC name is 1-(4-chloro-3-cyclopentyloxyphenyl)-1,1-difluoropropan-2-ol.
| Compound Name | 1-(4-chloro-3-cyclopentyloxyphenyl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 162262584 |
| Molecular Formula | C14H17ClF2O2 |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-(4-chloro-3-cyclopentyloxyphenyl)-1,1-difluoropropan-2-ol |
| SMILES | CC(O)C(F)(F)c1ccc(Cl)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C14H17ClF2O2/c1-9(18)14(16,17)10-6-7-12(15)13(8-10)19-11-4-2-3-5-11/h6-9,11,18H,2-5H2,1H3 |
| InChIKey | VSNICUKDDMKQBV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |