C19H23F3N2O5 — CID 168567052
dimethyl (E)-2-[2-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate (PubChem CID 168567052) has the molecular formula C19H23F3N2O5 and a molecular weight of 416.40 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567052 |
| Molecular Formula | C19H23F3N2O5 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | dimethyl (E)-2-[2-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C(F)(F)F)ccc1OC1CCN(C)CC1)C(=O)OC |
| InChI | InChI=1S/C19H23F3N2O5/c1-24-8-6-13(7-9-24)29-16-5-4-12(19(20,21)22)10-14(16)23-15(18(26)28-3)11-17(25)27-2/h4-5,10-11,13,23H,6-9H2,1-3H3/b15-11+ |
| InChIKey | YQXASZNQIWRJKL-RVDMUPIBSA-N |
| XLogP | 2.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|