C23H33N3O5 — CID 168570424
dimethyl (E)-2-[2-methoxy-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]but-2-enedioate (PubChem CID 168570424) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is dimethyl (E)-2-[2-methoxy-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-methoxy-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570424 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | dimethyl (E)-2-[2-methoxy-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(N2CCC3(CCN(C)CC3)CC2)cc1OC)C(=O)OC |
| InChI | InChI=1S/C23H33N3O5/c1-25-11-7-23(8-12-25)9-13-26(14-10-23)17-5-6-18(20(15-17)29-2)24-19(22(28)31-4)16-21(27)30-3/h5-6,15-16,24H,7-14H2,1-4H3/b19-16+ |
| InChIKey | BCBNOYZZVUGKGC-KNTRCKAVSA-N |
| XLogP | 2.65 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|