C18H24N2O7 — CID 168568591
dimethyl (E)-2-(2,5-dimethoxy-4-morpholin-4-ylanilino)but-2-enedioate (PubChem CID 168568591) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is dimethyl (E)-2-(2,5-dimethoxy-4-morpholin-4-ylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(2,5-dimethoxy-4-morpholin-4-ylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168568591 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | dimethyl (E)-2-(2,5-dimethoxy-4-morpholin-4-ylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(OC)c(N2CCOCC2)cc1OC)C(=O)OC |
| InChI | InChI=1S/C18H24N2O7/c1-23-15-11-14(20-5-7-27-8-6-20)16(24-2)9-12(15)19-13(18(22)26-4)10-17(21)25-3/h9-11,19H,5-8H2,1-4H3/b13-10+ |
| InChIKey | RWQNGBWHQMEMNW-JLHYYAGUSA-N |
| XLogP | 1.18 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|