C17H20N2O7 — CID 168566561
3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-morpholin-4-ylbenzoic acid (PubChem CID 168566561) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is 3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-morpholin-4-ylbenzoic acid.
| Compound Name | 3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 168566561 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-morpholin-4-ylbenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1cccc(C(=O)O)c1N1CCOCC1)C(=O)OC |
| InChI | InChI=1S/C17H20N2O7/c1-24-14(20)10-13(17(23)25-2)18-12-5-3-4-11(16(21)22)15(12)19-6-8-26-9-7-19/h3-5,10,18H,6-9H2,1-2H3,(H,21,22)/b13-10+ |
| InChIKey | LJVBOZYEYHNONT-JLHYYAGUSA-N |
| XLogP | 0.86 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|