C19H24ClN3O6 — CID 168568407
dimethyl (E)-2-[3-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)anilino]but-2-enedioate (PubChem CID 168568407) has the molecular formula C19H24ClN3O6 and a molecular weight of 425.87 g/mol. Its IUPAC name is dimethyl (E)-2-[3-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568407 |
| Molecular Formula | C19H24ClN3O6 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | dimethyl (E)-2-[3-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)anilino]but-2-enedioate |
| SMILES | CCOC(=O)N1CCN(c2c(Cl)cccc2N/C(=C/C(=O)OC)C(=O)OC)CC1 |
| InChI | InChI=1S/C19H24ClN3O6/c1-4-29-19(26)23-10-8-22(9-11-23)17-13(20)6-5-7-14(17)21-15(18(25)28-3)12-16(24)27-2/h5-7,12,21H,4,8-11H2,1-3H3/b15-12+ |
| InChIKey | BVRHJAKJWGQWKW-NTCAYCPXSA-N |
| XLogP | 2.26 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|