C16H23Cl2N3O3 — CID 168639349
ethyl 4-[2-chloro-6-[(3-chloro-2-hydroxypropyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 168639349) has the molecular formula C16H23Cl2N3O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is ethyl 4-[2-chloro-6-[(3-chloro-2-hydroxypropyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-chloro-6-[(3-chloro-2-hydroxypropyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168639349 |
| Molecular Formula | C16H23Cl2N3O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 4-[2-chloro-6-[(3-chloro-2-hydroxypropyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2c(Cl)cccc2NCC(O)CCl)CC1 |
| InChI | InChI=1S/C16H23Cl2N3O3/c1-2-24-16(23)21-8-6-20(7-9-21)15-13(18)4-3-5-14(15)19-11-12(22)10-17/h3-5,12,19,22H,2,6-11H2,1H3 |
| InChIKey | OXTLWXPPWFRDDF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|