C16H19FN2O4 — CID 168567982
dimethyl (E)-2-(3-fluoro-2-pyrrolidin-1-ylanilino)but-2-enedioate (PubChem CID 168567982) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is dimethyl (E)-2-(3-fluoro-2-pyrrolidin-1-ylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(3-fluoro-2-pyrrolidin-1-ylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168567982 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | dimethyl (E)-2-(3-fluoro-2-pyrrolidin-1-ylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc(F)c1N1CCCC1)C(=O)OC |
| InChI | InChI=1S/C16H19FN2O4/c1-22-14(20)10-13(16(21)23-2)18-12-7-5-6-11(17)15(12)19-8-3-4-9-19/h5-7,10,18H,3-4,8-9H2,1-2H3/b13-10+ |
| InChIKey | UDZTVMWWPVHUBU-JLHYYAGUSA-N |
| XLogP | 2.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|