C15H13F6NO5 — CID 168567392
dimethyl (E)-2-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate (PubChem CID 168567392) has the molecular formula C15H13F6NO5 and a molecular weight of 401.26 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567392 |
| Molecular Formula | C15H13F6NO5 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | dimethyl (E)-2-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C(F)(F)F)ccc1OCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C15H13F6NO5/c1-25-12(23)6-10(13(24)26-2)22-9-5-8(15(19,20)21)3-4-11(9)27-7-14(16,17)18/h3-6,22H,7H2,1-2H3/b10-6+ |
| InChIKey | GUUNGBPGBOXCHO-UXBLZVDNSA-N |
| XLogP | 3.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|