C19H22F3N3O5 — CID 168569868
dimethyl (E)-2-[4-(4-methylpiperazine-1-carbonyl)-3-(trifluoromethyl)anilino]but-2-enedioate (PubChem CID 168569868) has the molecular formula C19H22F3N3O5 and a molecular weight of 429.40 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(4-methylpiperazine-1-carbonyl)-3-(trifluoromethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(4-methylpiperazine-1-carbonyl)-3-(trifluoromethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569868 |
| Molecular Formula | C19H22F3N3O5 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | dimethyl (E)-2-[4-(4-methylpiperazine-1-carbonyl)-3-(trifluoromethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(C(=O)N2CCN(C)CC2)c(C(F)(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C19H22F3N3O5/c1-24-6-8-25(9-7-24)17(27)13-5-4-12(10-14(13)19(20,21)22)23-15(18(28)30-3)11-16(26)29-2/h4-5,10-11,23H,6-9H2,1-3H3/b15-11+ |
| InChIKey | JJPZPUFVCBEHPH-RVDMUPIBSA-N |
| XLogP | 1.73 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|