C17H20N2O5 — CID 168568267
dimethyl (E)-2-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]but-2-enedioate (PubChem CID 168568267) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is dimethyl (E)-2-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168568267 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | dimethyl (E)-2-[(2-acetyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc2c(c1)CN(C(C)=O)CC2)C(=O)OC |
| InChI | InChI=1S/C17H20N2O5/c1-11(20)19-7-6-12-4-5-14(8-13(12)10-19)18-15(17(22)24-3)9-16(21)23-2/h4-5,8-9,18H,6-7,10H2,1-3H3/b15-9+ |
| InChIKey | XYZZOUQCONKCDT-OQLLNIDSSA-N |
| XLogP | 1.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|