C14H9Cl3F3N3S — CID 84820031
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(3,5-dichlorophenyl)thiourea (PubChem CID 84820031) has the molecular formula C14H9Cl3F3N3S and a molecular weight of 414.67 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 84820031 |
| Molecular Formula | C14H9Cl3F3N3S |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(3,5-dichlorophenyl)thiourea |
| SMILES | FC(F)(F)c1cnc(CNC(=S)Nc2cc(Cl)cc(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl3F3N3S/c15-8-2-9(16)4-10(3-8)23-13(24)22-6-12-11(17)1-7(5-21-12)14(18,19)20/h1-5H,6H2,(H2,22,23,24) |
| InChIKey | YDYGIHFBRVQEMB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_E(7)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|