C12H10Cl3N5S — CID 54584381
1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,5-dichlorophenyl)thiourea (PubChem CID 54584381) has the molecular formula C12H10Cl3N5S and a molecular weight of 362.67 g/mol. Its IUPAC name is 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 54584381 |
| Molecular Formula | C12H10Cl3N5S |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(3,5-dichlorophenyl)thiourea |
| SMILES | Nc1ncc(Cl)nc1CNC(=S)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H10Cl3N5S/c13-6-1-7(14)3-8(2-6)19-12(21)18-4-9-11(16)17-5-10(15)20-9/h1-3,5H,4H2,(H2,16,17)(H2,18,19,21) |
| InChIKey | OKKIRFVLOKJGRI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|