C15H19N — CID 142348400
(1R)-N-benzyl-1-cyclohexa-1,5-dien-1-ylethanamine (PubChem CID 142348400) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (1R)-N-benzyl-1-cyclohexa-1,5-dien-1-ylethanamine.
| Compound Name | (1R)-N-benzyl-1-cyclohexa-1,5-dien-1-ylethanamine |
|---|---|
| PubChem CID | 142348400 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (1R)-N-benzyl-1-cyclohexa-1,5-dien-1-ylethanamine |
| SMILES | C[C@@H](NCc1ccccc1)C1=CCCC=C1 |
| InChI | InChI=1S/C15H19N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2,4-6,8-11,13,16H,3,7,12H2,1H3/t13-/m1/s1 |
| InChIKey | TYTSQMGUSWLTOS-CYBMUJFWSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |