C17H24 — CID 156726896
1-cyclohexa-1,5-dien-1-ylpropylbenzene;ethane (PubChem CID 156726896) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-ylpropylbenzene;ethane.
| Compound Name | 1-cyclohexa-1,5-dien-1-ylpropylbenzene;ethane |
|---|---|
| PubChem CID | 156726896 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-ylpropylbenzene;ethane |
| SMILES | CC.CCC(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C15H18.C2H6/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-2/h3,5-7,9-12,15H,2,4,8H2,1H3;1-2H3 |
| InChIKey | PNMHKVUWVXIGCC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |