C19H25N — CID 143466576
N-(3-cyclohexa-1,5-dien-1-yl-3-phenylpropyl)but-1-en-2-amine (PubChem CID 143466576) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is N-(3-cyclohexa-1,5-dien-1-yl-3-phenylpropyl)but-1-en-2-amine.
| Compound Name | N-(3-cyclohexa-1,5-dien-1-yl-3-phenylpropyl)but-1-en-2-amine |
|---|---|
| PubChem CID | 143466576 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-(3-cyclohexa-1,5-dien-1-yl-3-phenylpropyl)but-1-en-2-amine |
| SMILES | C=C(CC)NCCC(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-3-16(2)20-15-14-19(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4,6-8,10-13,19-20H,2-3,5,9,14-15H2,1H3 |
| InChIKey | KTTZZKZLJJEZIX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |