C12H19N — CID 144925841
N-(2-cyclohexa-1,5-dien-1-ylethyl)but-1-en-2-amine (PubChem CID 144925841) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-(2-cyclohexa-1,5-dien-1-ylethyl)but-1-en-2-amine.
| Compound Name | N-(2-cyclohexa-1,5-dien-1-ylethyl)but-1-en-2-amine |
|---|---|
| PubChem CID | 144925841 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-(2-cyclohexa-1,5-dien-1-ylethyl)but-1-en-2-amine |
| SMILES | C=C(CC)NCCC1=CCCC=C1 |
| InChI | InChI=1S/C12H19N/c1-3-11(2)13-10-9-12-7-5-4-6-8-12/h5,7-8,13H,2-4,6,9-10H2,1H3 |
| InChIKey | KNCMXZMJFRFOAW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |