C21H40N4O — CID 144937648
1-(2-cyclohexa-1,5-dien-1-ylethyl)-3-[(3Z)-3-ethenylhexa-3,5-dienyl]urea;ethane;methanamine (PubChem CID 144937648) has the molecular formula C21H40N4O and a molecular weight of 364.58 g/mol. Its IUPAC name is 1-(2-cyclohexa-1,5-dien-1-ylethyl)-3-[(3Z)-3-ethenylhexa-3,5-dienyl]urea;ethane;methanamine.
| Compound Name | 1-(2-cyclohexa-1,5-dien-1-ylethyl)-3-[(3Z)-3-ethenylhexa-3,5-dienyl]urea;ethane;methanamine |
|---|---|
| PubChem CID | 144937648 |
| Molecular Formula | C21H40N4O |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.32 |
| IUPAC Name | 1-(2-cyclohexa-1,5-dien-1-ylethyl)-3-[(3Z)-3-ethenylhexa-3,5-dienyl]urea;ethane;methanamine |
| SMILES | C=C/C=C(\C=C)CCNC(=O)NCCC1=CCCC=C1.CC.CN.CN |
| InChI | InChI=1S/C17H24N2O.C2H6.2CH5N/c1-3-8-15(4-2)11-13-18-17(20)19-14-12-16-9-6-5-7-10-16;3*1-2/h3-4,6,8-10H,1-2,5,7,11-14H2,(H2,18,19,20);1-2H3;2*2H2,1H3/b15-8+;;; |
| InChIKey | KZUCPGUYRXVEDF-BAESOZIDSA-N |
| XLogP | 3.82 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|