C20H30N2 — CID 142018019
ethane;1-N'-[(3Z)-3-ethenylhexa-3,5-dienyl]-1-N-(2-phenylethyl)ethene-1,1-diamine (PubChem CID 142018019) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is ethane;1-N'-[(3Z)-3-ethenylhexa-3,5-dienyl]-1-N-(2-phenylethyl)ethene-1,1-diamine.
| Compound Name | ethane;1-N'-[(3Z)-3-ethenylhexa-3,5-dienyl]-1-N-(2-phenylethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 142018019 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | ethane;1-N'-[(3Z)-3-ethenylhexa-3,5-dienyl]-1-N-(2-phenylethyl)ethene-1,1-diamine |
| SMILES | C=C/C=C(\C=C)CCNC(=C)NCCc1ccccc1.CC |
| InChI | InChI=1S/C18H24N2.C2H6/c1-4-9-17(5-2)12-14-19-16(3)20-15-13-18-10-7-6-8-11-18;1-2/h4-11,19-20H,1-3,12-15H2;1-2H3/b17-9+; |
| InChIKey | KIUGSQPEYBQRBF-WWIHJBQESA-N |
| XLogP | 4.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|