C17H24N4S — CID 142116820
1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-[3-methyl-4-(2-methylhydrazinyl)phenyl]thiourea (PubChem CID 142116820) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-[3-methyl-4-(2-methylhydrazinyl)phenyl]thiourea.
| Compound Name | 1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-[3-methyl-4-(2-methylhydrazinyl)phenyl]thiourea |
|---|---|
| PubChem CID | 142116820 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-[3-methyl-4-(2-methylhydrazinyl)phenyl]thiourea |
| SMILES | C=C/C=C(\C=C)CCNC(=S)Nc1ccc(NNC)c(C)c1 |
| InChI | InChI=1S/C17H24N4S/c1-5-7-14(6-2)10-11-19-17(22)20-15-8-9-16(21-18-4)13(3)12-15/h5-9,12,18,21H,1-2,10-11H2,3-4H3,(H2,19,20,22)/b14-7+ |
| InChIKey | LSBWNBAEHHHZOR-VGOFMYFVSA-N |
| XLogP | 3.52 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|