C20H28N2S — CID 7944061
1-(1-adamantylmethyl)-3-(3,4-dimethylphenyl)thiourea (PubChem CID 7944061) has the molecular formula C20H28N2S and a molecular weight of 328.52 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-(1-adamantylmethyl)-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7944061 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCC23CC4CC(CC(C4)C2)C3)cc1C |
| InChI | InChI=1S/C20H28N2S/c1-13-3-4-18(5-14(13)2)22-19(23)21-12-20-9-15-6-16(10-20)8-17(7-15)11-20/h3-5,15-17H,6-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | BNELDOOBAQCILZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|