C21H25FN2S — CID 100757469
1-(3,4-dimethylphenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea (PubChem CID 100757469) has the molecular formula C21H25FN2S and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
|---|---|
| PubChem CID | 100757469 |
| Molecular Formula | C21H25FN2S |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCC2(c3ccc(F)cc3)CCCC2)cc1C |
| InChI | InChI=1S/C21H25FN2S/c1-15-5-10-19(13-16(15)2)24-20(25)23-14-21(11-3-4-12-21)17-6-8-18(22)9-7-17/h5-10,13H,3-4,11-12,14H2,1-2H3,(H2,23,24,25) |
| InChIKey | DFZWCDPLYOTBAR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|