C23H26FN3OS — CID 100757700
1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100757700) has the molecular formula C23H26FN3OS and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100757700 |
| Molecular Formula | C23H26FN3OS |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | O=C1CCCN1c1ccc(NC(=S)NCC2(c3ccc(F)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C23H26FN3OS/c24-18-7-5-17(6-8-18)23(13-1-2-14-23)16-25-22(29)26-19-9-11-20(12-10-19)27-15-3-4-21(27)28/h5-12H,1-4,13-16H2,(H2,25,26,29) |
| InChIKey | PKBOLGIVLQXTFZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|