C19H19BrClFN2S — CID 100757628
1-(4-bromo-3-chlorophenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea (PubChem CID 100757628) has the molecular formula C19H19BrClFN2S and a molecular weight of 441.80 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
|---|---|
| PubChem CID | 100757628 |
| Molecular Formula | C19H19BrClFN2S |
| Molecular Weight | 441.80 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
| SMILES | Fc1ccc(C2(CNC(=S)Nc3ccc(Br)c(Cl)c3)CCCC2)cc1 |
| InChI | InChI=1S/C19H19BrClFN2S/c20-16-8-7-15(11-17(16)21)24-18(25)23-12-19(9-1-2-10-19)13-3-5-14(22)6-4-13/h3-8,11H,1-2,9-10,12H2,(H2,23,24,25) |
| InChIKey | UAEPWSDEOYBBGD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.80 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|