C18H22Cl2N2S — CID 5111367
1-(1-adamantylmethyl)-3-(2,4-dichlorophenyl)thiourea (PubChem CID 5111367) has the molecular formula C18H22Cl2N2S and a molecular weight of 369.36 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-(2,4-dichlorophenyl)thiourea.
| Compound Name | 1-(1-adamantylmethyl)-3-(2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 5111367 |
| Molecular Formula | C18H22Cl2N2S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-(2,4-dichlorophenyl)thiourea |
| SMILES | S=C(NCC12CC3CC(CC(C3)C1)C2)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N2S/c19-14-1-2-16(15(20)6-14)22-17(23)21-10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13H,3-5,7-10H2,(H2,21,22,23) |
| InChIKey | LQVKAXPJKGLDNZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|