C22H32N2S — CID 40621707
1-(1-adamantylmethyl)-3-[4-[(2S)-butan-2-yl]phenyl]thiourea (PubChem CID 40621707) has the molecular formula C22H32N2S and a molecular weight of 356.58 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-[4-[(2S)-butan-2-yl]phenyl]thiourea.
| Compound Name | 1-(1-adamantylmethyl)-3-[4-[(2S)-butan-2-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 40621707 |
| Molecular Formula | C22H32N2S |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-[4-[(2S)-butan-2-yl]phenyl]thiourea |
| SMILES | CC[C@H](C)c1ccc(NC(=S)NCC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H32N2S/c1-3-15(2)19-4-6-20(7-5-19)24-21(25)23-14-22-11-16-8-17(12-22)10-18(9-16)13-22/h4-7,15-18H,3,8-14H2,1-2H3,(H2,23,24,25)/t15-,16?,17?,18?,22?/m0/s1 |
| InChIKey | CPHHXVCQPGCVPA-BZSISCHUSA-N |
| XLogP | 5.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|