C21H31N3O2S2 — CID 19679134
1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2-methylpropyl)thiourea (PubChem CID 19679134) has the molecular formula C21H31N3O2S2 and a molecular weight of 421.63 g/mol. Its IUPAC name is 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 19679134 |
| Molecular Formula | C21H31N3O2S2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1ccc(S(=O)(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H31N3O2S2/c1-14(2)13-22-20(27)23-18-3-5-19(6-4-18)28(25,26)24-21-10-15-7-16(11-21)9-17(8-15)12-21/h3-6,14-17,24H,7-13H2,1-2H3,(H2,22,23,27) |
| InChIKey | PNJKXPMHACDCRT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|