C18H23N3S — CID 3859417
1-[[4-(dimethylamino)phenyl]methyl]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 3859417) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 3859417 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCc2ccc(N(C)C)cc2)cc1C |
| InChI | InChI=1S/C18H23N3S/c1-13-5-8-16(11-14(13)2)20-18(22)19-12-15-6-9-17(10-7-15)21(3)4/h5-11H,12H2,1-4H3,(H2,19,20,22) |
| InChIKey | KEHWEFPHSAUYOP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|