C21H26N2O3 — CID 8003560
[2-(3,4-dimethylanilino)-2-oxoethyl] 3-[4-(dimethylamino)phenyl]propanoate (PubChem CID 8003560) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 3-[4-(dimethylamino)phenyl]propanoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-[4-(dimethylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 8003560 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-[4-(dimethylamino)phenyl]propanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCc2ccc(N(C)C)cc2)cc1C |
| InChI | InChI=1S/C21H26N2O3/c1-15-5-9-18(13-16(15)2)22-20(24)14-26-21(25)12-8-17-6-10-19(11-7-17)23(3)4/h5-7,9-11,13H,8,12,14H2,1-4H3,(H,22,24) |
| InChIKey | GMEIRTPJNPXTTK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|