C19H21NO3 — CID 71822771
[2-(3,4-dimethylanilino)-2-oxoethyl] 2-(3-methylphenyl)acetate (PubChem CID 71822771) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(3-methylphenyl)acetate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(3-methylphenyl)acetate |
|---|---|
| PubChem CID | 71822771 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(3-methylphenyl)acetate |
| SMILES | Cc1cccc(CC(=O)OCC(=O)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H21NO3/c1-13-5-4-6-16(9-13)11-19(22)23-12-18(21)20-17-8-7-14(2)15(3)10-17/h4-10H,11-12H2,1-3H3,(H,20,21) |
| InChIKey | INYVRPKFBFRZBJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |