C17H16FNO3 — CID 7874560
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenylacetate (PubChem CID 7874560) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenylacetate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenylacetate |
|---|---|
| PubChem CID | 7874560 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenylacetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)Cc2ccccc2)cc1F |
| InChI | InChI=1S/C17H16FNO3/c1-12-7-8-14(10-15(12)18)19-16(20)11-22-17(21)9-13-5-3-2-4-6-13/h2-8,10H,9,11H2,1H3,(H,19,20) |
| InChIKey | ZCUQLFHFMIQKPT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |