C16H16FNO — CID 668304
N-(3-fluoro-4-methylphenyl)-3-phenylpropanamide (PubChem CID 668304) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-3-phenylpropanamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 668304 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-3-phenylpropanamide |
| SMILES | Cc1ccc(NC(=O)CCc2ccccc2)cc1F |
| InChI | InChI=1S/C16H16FNO/c1-12-7-9-14(11-15(12)17)18-16(19)10-8-13-5-3-2-4-6-13/h2-7,9,11H,8,10H2,1H3,(H,18,19) |
| InChIKey | ZNVYFQVPIPNWFB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |