C23H27NO4 — CID 7227164
[2-(3,4-dimethylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate (PubChem CID 7227164) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate |
|---|---|
| PubChem CID | 7227164 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate |
| SMILES | CCCc1ccc(C(=O)CCC(=O)OCC(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-4-5-18-7-9-19(10-8-18)21(25)12-13-23(27)28-15-22(26)24-20-11-6-16(2)17(3)14-20/h6-11,14H,4-5,12-13,15H2,1-3H3,(H,24,26) |
| InChIKey | YPOOGMZRQHQHQF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |