C22H24FNO4 — CID 7227096
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate (PubChem CID 7227096) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate |
|---|---|
| PubChem CID | 7227096 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-oxo-4-(4-propylphenyl)butanoate |
| SMILES | CCCc1ccc(C(=O)CCC(=O)OCC(=O)Nc2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C22H24FNO4/c1-3-4-16-6-8-17(9-7-16)20(25)11-12-22(27)28-14-21(26)24-18-10-5-15(2)19(23)13-18/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,24,26) |
| InChIKey | NYXZCFJNUJBAQG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |