C25H31NO4 — CID 7198194
[2-(4-ethylanilino)-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate (PubChem CID 7198194) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is [2-(4-ethylanilino)-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate.
| Compound Name | [2-(4-ethylanilino)-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
|---|---|
| PubChem CID | 7198194 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | [2-(4-ethylanilino)-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
| SMILES | CCCCCc1ccc(C(=O)CCC(=O)OCC(=O)Nc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C25H31NO4/c1-3-5-6-7-20-8-12-21(13-9-20)23(27)16-17-25(29)30-18-24(28)26-22-14-10-19(4-2)11-15-22/h8-15H,3-7,16-18H2,1-2H3,(H,26,28) |
| InChIKey | LGJRBWWZEKDPRX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|