C28H36N2O5 — CID 42981679
[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 4-oxo-4-(4-pentylphenyl)butanoate (PubChem CID 42981679) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 4-oxo-4-(4-pentylphenyl)butanoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
|---|---|
| PubChem CID | 42981679 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
| SMILES | CCCCCc1ccc(C(=O)CCC(=O)OCC(=O)NCC(=O)Nc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C28H36N2O5/c1-5-6-7-8-22-9-11-23(12-10-22)24(31)13-14-27(34)35-18-26(33)29-17-25(32)30-28-20(3)15-19(2)16-21(28)4/h9-12,15-16H,5-8,13-14,17-18H2,1-4H3,(H,29,33)(H,30,32) |
| InChIKey | LSELBMCWNDXTHZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|