C23H28N2O3 — CID 27718932
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxo-4-(4-propylphenyl)butanamide (PubChem CID 27718932) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxo-4-(4-propylphenyl)butanamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxo-4-(4-propylphenyl)butanamide |
|---|---|
| PubChem CID | 27718932 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxo-4-(4-propylphenyl)butanamide |
| SMILES | CCCc1ccc(C(=O)CCC(=O)NCC(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-4-6-18-9-11-19(12-10-18)20(26)13-14-21(27)24-15-22(28)25-23-16(2)7-5-8-17(23)3/h5,7-12H,4,6,13-15H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | OOSXQVYQEFQTPT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |