C22H24N2O4S — CID 4298194
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate (PubChem CID 4298194) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
|---|---|
| PubChem CID | 4298194 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
| SMILES | CCCCCc1ccc(C(=O)CCC(=O)OCC(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-2-3-4-5-16-6-8-17(9-7-16)19(25)10-11-21(27)28-15-20(26)24-22-18(14-23)12-13-29-22/h6-9,12-13H,2-5,10-11,15H2,1H3,(H,24,26) |
| InChIKey | CLPAAUFGGDITIZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|