C16H13FN2O3S — CID 8552867
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-fluorophenyl)propanoate (PubChem CID 8552867) has the molecular formula C16H13FN2O3S and a molecular weight of 332.36 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 8552867 |
| Molecular Formula | C16H13FN2O3S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-fluorophenyl)propanoate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN2O3S/c17-13-4-1-11(2-5-13)3-6-15(21)22-10-14(20)19-16-12(9-18)7-8-23-16/h1-2,4-5,7-8H,3,6,10H2,(H,19,20) |
| InChIKey | UZUHMYHLNVABHC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |