C17H15N3O5S — CID 8788004
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate (PubChem CID 8788004) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8788004 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCC(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C17H15N3O5S/c1-24-13-4-2-11(3-5-13)16(23)19-9-15(22)25-10-14(21)20-17-12(8-18)6-7-26-17/h2-7H,9-10H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | CBYSXKCZCPFHCC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |