C20H20FNO5 — CID 9325956
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate (PubChem CID 9325956) has the molecular formula C20H20FNO5 and a molecular weight of 373.38 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 9325956 |
| Molecular Formula | C20H20FNO5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCC(=O)Nc2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C20H20FNO5/c1-3-18(23)14-5-8-16(9-6-14)26-12-20(25)27-11-19(24)22-15-7-4-13(2)17(21)10-15/h4-10H,3,11-12H2,1-2H3,(H,22,24) |
| InChIKey | UYBCBFSTWCELMD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |