C19H17ClFNO5 — CID 40719319
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate (PubChem CID 40719319) has the molecular formula C19H17ClFNO5 and a molecular weight of 393.80 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 40719319 |
| Molecular Formula | C19H17ClFNO5 |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCC(=O)Nc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C19H17ClFNO5/c1-2-17(23)12-3-6-14(7-4-12)26-11-19(25)27-10-18(24)22-16-8-5-13(21)9-15(16)20/h3-9H,2,10-11H2,1H3,(H,22,24) |
| InChIKey | DIJFGPGKGIXVHP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |