C15H18O — CID 142924342
(4Z)-4-ethenyl-1-phenylhepta-4,6-dien-1-ol (PubChem CID 142924342) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (4Z)-4-ethenyl-1-phenylhepta-4,6-dien-1-ol.
| Compound Name | (4Z)-4-ethenyl-1-phenylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 142924342 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (4Z)-4-ethenyl-1-phenylhepta-4,6-dien-1-ol |
| SMILES | C=C/C=C(\C=C)CCC(O)c1ccccc1 |
| InChI | InChI=1S/C15H18O/c1-3-8-13(4-2)11-12-15(16)14-9-6-5-7-10-14/h3-10,15-16H,1-2,11-12H2/b13-8+ |
| InChIKey | DJWGTUMYAMPVBG-MDWZMJQESA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|